C14H20N2O5 — CID 119305084
4-amino-N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]butanamide (PubChem CID 119305084) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-amino-N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]butanamide.
| Compound Name | 4-amino-N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]butanamide |
|---|---|
| PubChem CID | 119305084 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-amino-N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]butanamide |
| SMILES | NCCCC(=O)NCC(O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O5/c15-5-1-2-14(18)16-7-10(17)8-19-11-3-4-12-13(6-11)21-9-20-12/h3-4,6,10,17H,1-2,5,7-9,15H2,(H,16,18) |
| InChIKey | VZTJQHNUQGUGJF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |