C20H22ClNO6 — CID 47929884
N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-4-(4-chlorophenoxy)butanamide (PubChem CID 47929884) has the molecular formula C20H22ClNO6 and a molecular weight of 407.85 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-4-(4-chlorophenoxy)butanamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-4-(4-chlorophenoxy)butanamide |
|---|---|
| PubChem CID | 47929884 |
| Molecular Formula | C20H22ClNO6 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-4-(4-chlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1)NCC(O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H22ClNO6/c21-14-3-5-16(6-4-14)25-9-1-2-20(24)22-11-15(23)12-26-17-7-8-18-19(10-17)28-13-27-18/h3-8,10,15,23H,1-2,9,11-13H2,(H,22,24) |
| InChIKey | MWCCSFDHDSGNOL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|