C17H16ClNO5 — CID 94799470
N-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-2-chlorobenzamide (PubChem CID 94799470) has the molecular formula C17H16ClNO5 and a molecular weight of 349.77 g/mol. Its IUPAC name is N-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-2-chlorobenzamide.
| Compound Name | N-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 94799470 |
| Molecular Formula | C17H16ClNO5 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-2-chlorobenzamide |
| SMILES | O=C(NC[C@H](O)COc1ccc2c(c1)OCO2)c1ccccc1Cl |
| InChI | InChI=1S/C17H16ClNO5/c18-14-4-2-1-3-13(14)17(21)19-8-11(20)9-22-12-5-6-15-16(7-12)24-10-23-15/h1-7,11,20H,8-10H2,(H,19,21)/t11-/m0/s1 |
| InChIKey | VAPUCWAFNLJDEL-NSHDSACASA-N |
| XLogP | 2.24 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |