C17H17FN2O5 — CID 51102218
1-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-3-(3-fluorophenyl)urea (PubChem CID 51102218) has the molecular formula C17H17FN2O5 and a molecular weight of 348.33 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 51102218 |
| Molecular Formula | C17H17FN2O5 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(NCC(O)COc1ccc2c(c1)OCO2)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H17FN2O5/c18-11-2-1-3-12(6-11)20-17(22)19-8-13(21)9-23-14-4-5-15-16(7-14)25-10-24-15/h1-7,13,21H,8-10H2,(H2,19,20,22) |
| InChIKey | CRXWKVMOHAQTRQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |