C19H31FO4 — CID 141205651
(2R,3R,12R)-13-(4-fluorophenoxy)tridecane-2,3,12-triol (PubChem CID 141205651) has the molecular formula C19H31FO4 and a molecular weight of 342.45 g/mol. Its IUPAC name is (2R,3R,12R)-13-(4-fluorophenoxy)tridecane-2,3,12-triol.
| Compound Name | (2R,3R,12R)-13-(4-fluorophenoxy)tridecane-2,3,12-triol |
|---|---|
| PubChem CID | 141205651 |
| Molecular Formula | C19H31FO4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (2R,3R,12R)-13-(4-fluorophenoxy)tridecane-2,3,12-triol |
| SMILES | C[C@@H](O)[C@H](O)CCCCCCCC[C@@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C19H31FO4/c1-15(21)19(23)9-7-5-3-2-4-6-8-17(22)14-24-18-12-10-16(20)11-13-18/h10-13,15,17,19,21-23H,2-9,14H2,1H3/t15-,17-,19-/m1/s1 |
| InChIKey | DIAFMACWIKVSOZ-SZVBFZGTSA-N |
| XLogP | 3.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|