C18H21FO4S — CID 59048736
(2S)-5-(benzenesulfonyl)-1-(4-fluorophenoxy)hexan-2-ol (PubChem CID 59048736) has the molecular formula C18H21FO4S and a molecular weight of 352.43 g/mol. Its IUPAC name is (2S)-5-(benzenesulfonyl)-1-(4-fluorophenoxy)hexan-2-ol.
| Compound Name | (2S)-5-(benzenesulfonyl)-1-(4-fluorophenoxy)hexan-2-ol |
|---|---|
| PubChem CID | 59048736 |
| Molecular Formula | C18H21FO4S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (2S)-5-(benzenesulfonyl)-1-(4-fluorophenoxy)hexan-2-ol |
| SMILES | CC(CC[C@H](O)COc1ccc(F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21FO4S/c1-14(24(21,22)18-5-3-2-4-6-18)7-10-16(20)13-23-17-11-8-15(19)9-12-17/h2-6,8-9,11-12,14,16,20H,7,10,13H2,1H3/t14?,16-/m0/s1 |
| InChIKey | VLLNOZMXTIIPAZ-WMCAAGNKSA-N |
| XLogP | 3.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |