C20H26O6S2 — CID 86168417
2,7-bis(benzenesulfonyl)octane-4,5-diol (PubChem CID 86168417) has the molecular formula C20H26O6S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2,7-bis(benzenesulfonyl)octane-4,5-diol.
| Compound Name | 2,7-bis(benzenesulfonyl)octane-4,5-diol |
|---|---|
| PubChem CID | 86168417 |
| Molecular Formula | C20H26O6S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2,7-bis(benzenesulfonyl)octane-4,5-diol |
| SMILES | CC(CC(O)C(O)CC(C)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26O6S2/c1-15(27(23,24)17-9-5-3-6-10-17)13-19(21)20(22)14-16(2)28(25,26)18-11-7-4-8-12-18/h3-12,15-16,19-22H,13-14H2,1-2H3 |
| InChIKey | SCJSPKUKJCAMPD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |