C12H16O4S — CID 12842280
2-[2-(benzenesulfonyl)propyl]-1,3-dioxolane (PubChem CID 12842280) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)propyl]-1,3-dioxolane.
| Compound Name | 2-[2-(benzenesulfonyl)propyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 12842280 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[2-(benzenesulfonyl)propyl]-1,3-dioxolane |
| SMILES | CC(CC1OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O4S/c1-10(9-12-15-7-8-16-12)17(13,14)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3 |
| InChIKey | GOACTUYLYDXYOP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |