C11H14O4 — CID 14982487
2-(2-hydroperoxy-2-phenylethyl)-1,3-dioxolane (PubChem CID 14982487) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(2-hydroperoxy-2-phenylethyl)-1,3-dioxolane.
| Compound Name | 2-(2-hydroperoxy-2-phenylethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 14982487 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(2-hydroperoxy-2-phenylethyl)-1,3-dioxolane |
| SMILES | OOC(CC1OCCO1)c1ccccc1 |
| InChI | InChI=1S/C11H14O4/c12-15-10(8-11-13-6-7-14-11)9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | HKDUGRLRCFLALN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|