C26H30O2P+ — CID 101498477
5-(1,3-dioxolan-2-yl)pentyl-triphenylphosphanium (PubChem CID 101498477) has the molecular formula C26H30O2P+ and a molecular weight of 405.50 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)pentyl-triphenylphosphanium.
| Compound Name | 5-(1,3-dioxolan-2-yl)pentyl-triphenylphosphanium |
|---|---|
| PubChem CID | 101498477 |
| Molecular Formula | C26H30O2P+ |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)pentyl-triphenylphosphanium |
| SMILES | c1ccc([P+](CCCCCC2OCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H30O2P/c1-5-13-23(14-6-1)29(24-15-7-2-8-16-24,25-17-9-3-10-18-25)22-12-4-11-19-26-27-20-21-28-26/h1-3,5-10,13-18,26H,4,11-12,19-22H2/q+1 |
| InChIKey | OTOWUVKREGIPAH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|