C11H13FO4S — CID 14593286
2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,3-dioxolane (PubChem CID 14593286) has the molecular formula C11H13FO4S and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,3-dioxolane.
| Compound Name | 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 14593286 |
| Molecular Formula | C11H13FO4S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-2-fluoroethyl]-1,3-dioxolane |
| SMILES | O=S(=O)(c1ccccc1)C(F)CC1OCCO1 |
| InChI | InChI=1S/C11H13FO4S/c12-10(8-11-15-6-7-16-11)17(13,14)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2 |
| InChIKey | IARRDJTUTHKUCK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |