C22H28O4S2 — CID 132937122
2,2-bis(benzenesulfonyl)ethylcyclooctane (PubChem CID 132937122) has the molecular formula C22H28O4S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2,2-bis(benzenesulfonyl)ethylcyclooctane.
| Compound Name | 2,2-bis(benzenesulfonyl)ethylcyclooctane |
|---|---|
| PubChem CID | 132937122 |
| Molecular Formula | C22H28O4S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2,2-bis(benzenesulfonyl)ethylcyclooctane |
| SMILES | O=S(=O)(c1ccccc1)C(CC1CCCCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O4S2/c23-27(24,20-14-8-4-9-15-20)22(18-19-12-6-2-1-3-7-13-19)28(25,26)21-16-10-5-11-17-21/h4-5,8-11,14-17,19,22H,1-3,6-7,12-13,18H2 |
| InChIKey | JYDKGICHAHPJEG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |