C17H24N2O4S — CID 68717288
methyl 2-(benzenesulfonamidomethylideneamino)-3-cyclohexylpropanoate (PubChem CID 68717288) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is methyl 2-(benzenesulfonamidomethylideneamino)-3-cyclohexylpropanoate.
| Compound Name | methyl 2-(benzenesulfonamidomethylideneamino)-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 68717288 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | methyl 2-(benzenesulfonamidomethylideneamino)-3-cyclohexylpropanoate |
| SMILES | COC(=O)C(CC1CCCCC1)/N=C/NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-23-17(20)16(12-14-8-4-2-5-9-14)18-13-19-24(21,22)15-10-6-3-7-11-15/h3,6-7,10-11,13-14,16H,2,4-5,8-9,12H2,1H3,(H,18,19) |
| InChIKey | QWVZFYOSGGNVSB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|