C19H28N4O3S — CID 142973960
N-(benzenesulfonyl)-N'-(1-cyclohexylpropan-2-yl)methanimidamide;N-(cyanomethyl)formamide (PubChem CID 142973960) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N'-(1-cyclohexylpropan-2-yl)methanimidamide;N-(cyanomethyl)formamide.
| Compound Name | N-(benzenesulfonyl)-N'-(1-cyclohexylpropan-2-yl)methanimidamide;N-(cyanomethyl)formamide |
|---|---|
| PubChem CID | 142973960 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(benzenesulfonyl)-N'-(1-cyclohexylpropan-2-yl)methanimidamide;N-(cyanomethyl)formamide |
| SMILES | CC(CC1CCCCC1)/N=C/NS(=O)(=O)c1ccccc1.N#CCNC=O |
| InChI | InChI=1S/C16H24N2O2S.C3H4N2O/c1-14(12-15-8-4-2-5-9-15)17-13-18-21(19,20)16-10-6-3-7-11-16;4-1-2-5-3-6/h3,6-7,10-11,13-15H,2,4-5,8-9,12H2,1H3,(H,17,18);3H,2H2,(H,5,6) |
| InChIKey | AXHXRPDCNLDRBH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|