C15H21NO2S — CID 15305076
methyl 3-cyclohexyl-2-pyridin-2-ylsulfanylpropanoate (PubChem CID 15305076) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-pyridin-2-ylsulfanylpropanoate.
| Compound Name | methyl 3-cyclohexyl-2-pyridin-2-ylsulfanylpropanoate |
|---|---|
| PubChem CID | 15305076 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | methyl 3-cyclohexyl-2-pyridin-2-ylsulfanylpropanoate |
| SMILES | COC(=O)C(CC1CCCCC1)Sc1ccccn1 |
| InChI | InChI=1S/C15H21NO2S/c1-18-15(17)13(11-12-7-3-2-4-8-12)19-14-9-5-6-10-16-14/h5-6,9-10,12-13H,2-4,7-8,11H2,1H3 |
| InChIKey | CKNIILMOJSPIET-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |