C22H23NO2 — CID 67483982
methyl 3-cyclopentyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]propanoate (PubChem CID 67483982) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl 3-cyclopentyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]propanoate.
| Compound Name | methyl 3-cyclopentyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]propanoate |
|---|---|
| PubChem CID | 67483982 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | methyl 3-cyclopentyl-2-[4-(2-pyridin-2-ylethynyl)phenyl]propanoate |
| SMILES | COC(=O)C(CC1CCCC1)c1ccc(C#Cc2ccccn2)cc1 |
| InChI | InChI=1S/C22H23NO2/c1-25-22(24)21(16-18-6-2-3-7-18)19-12-9-17(10-13-19)11-14-20-8-4-5-15-23-20/h4-5,8-10,12-13,15,18,21H,2-3,6-7,16H2,1H3 |
| InChIKey | HCXSVCBEGHKHKG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|