C18H26O2S — CID 141028337
ethyl 3-cyclopentyl-2-(4-ethylsulfanylphenyl)propanoate (PubChem CID 141028337) has the molecular formula C18H26O2S and a molecular weight of 306.47 g/mol. Its IUPAC name is ethyl 3-cyclopentyl-2-(4-ethylsulfanylphenyl)propanoate.
| Compound Name | ethyl 3-cyclopentyl-2-(4-ethylsulfanylphenyl)propanoate |
|---|---|
| PubChem CID | 141028337 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | ethyl 3-cyclopentyl-2-(4-ethylsulfanylphenyl)propanoate |
| SMILES | CCOC(=O)C(CC1CCCC1)c1ccc(SCC)cc1 |
| InChI | InChI=1S/C18H26O2S/c1-3-20-18(19)17(13-14-7-5-6-8-14)15-9-11-16(12-10-15)21-4-2/h9-12,14,17H,3-8,13H2,1-2H3 |
| InChIKey | CDGBCGGTKHVYKY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |