C16H16N2O4S2 — CID 7140272
dimethyl (2S,3S)-2,3-bis(pyridin-2-ylsulfanyl)butanedioate (PubChem CID 7140272) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is dimethyl (2S,3S)-2,3-bis(pyridin-2-ylsulfanyl)butanedioate.
| Compound Name | dimethyl (2S,3S)-2,3-bis(pyridin-2-ylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 7140272 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | dimethyl (2S,3S)-2,3-bis(pyridin-2-ylsulfanyl)butanedioate |
| SMILES | COC(=O)[C@H](Sc1ccccn1)[C@@H](Sc1ccccn1)C(=O)OC |
| InChI | InChI=1S/C16H16N2O4S2/c1-21-15(19)13(23-11-7-3-5-9-17-11)14(16(20)22-2)24-12-8-4-6-10-18-12/h3-10,13-14H,1-2H3/t13-,14-/m1/s1 |
| InChIKey | OPAVZQBCFPCMBR-ZIAGYGMSSA-N |
| XLogP | 2.44 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |