C14H14O6S2 — CID 158874761
1,2-bis(benzenesulfonyl)ethane-1,2-diol (PubChem CID 158874761) has the molecular formula C14H14O6S2 and a molecular weight of 342.39 g/mol. Its IUPAC name is 1,2-bis(benzenesulfonyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(benzenesulfonyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 158874761 |
| Molecular Formula | C14H14O6S2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 1,2-bis(benzenesulfonyl)ethane-1,2-diol |
| SMILES | O=S(=O)(c1ccccc1)C(O)C(O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14O6S2/c15-13(21(17,18)11-7-3-1-4-8-11)14(16)22(19,20)12-9-5-2-6-10-12/h1-10,13-16H |
| InChIKey | JCHICCBYABXFJP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |