C8H9NO6S2 — CID 154414144
2-(benzenesulfonyl)-2-sulfamoylacetic acid (PubChem CID 154414144) has the molecular formula C8H9NO6S2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-sulfamoylacetic acid.
| Compound Name | 2-(benzenesulfonyl)-2-sulfamoylacetic acid |
|---|---|
| PubChem CID | 154414144 |
| Molecular Formula | C8H9NO6S2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 2-(benzenesulfonyl)-2-sulfamoylacetic acid |
| SMILES | NS(=O)(=O)C(C(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO6S2/c9-17(14,15)8(7(10)11)16(12,13)6-4-2-1-3-5-6/h1-5,8H,(H,10,11)(H2,9,14,15) |
| InChIKey | RDIOFUXVBCZZHN-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |