C20H17NO5S2 — CID 17339954
2,2-bis(benzenesulfonyl)-N-phenylacetamide (PubChem CID 17339954) has the molecular formula C20H17NO5S2 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2,2-bis(benzenesulfonyl)-N-phenylacetamide.
| Compound Name | 2,2-bis(benzenesulfonyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 17339954 |
| Molecular Formula | C20H17NO5S2 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2,2-bis(benzenesulfonyl)-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17NO5S2/c22-19(21-16-10-4-1-5-11-16)20(27(23,24)17-12-6-2-7-13-17)28(25,26)18-14-8-3-9-15-18/h1-15,20H,(H,21,22) |
| InChIKey | ISPQFRIDMZLGFO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |