About benzenesulfonamide;2-methylpropane
benzenesulfonamide;2-methylpropane (PubChem CID 157350693) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is benzenesulfonamide;2-methylpropane.
Molecular Properties
| Compound Name | benzenesulfonamide;2-methylpropane |
| PubChem CID | 157350693 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | benzenesulfonamide;2-methylpropane |
| SMILES | CC(C)C.NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C6H7NO2S.C4H10/c7-10(8,9)6-4-2-1-3-5-6;1-4(2)3/h1-5H,(H2,7,8,9);4H,1-3H3 |
| InChIKey | BHMMRYPINNRSNB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzenesulfonamide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonamide;2-methylpropane?
The IUPAC name of benzenesulfonamide;2-methylpropane (CID 157350693) is benzenesulfonamide;2-methylpropane.
What is the SMILES notation for benzenesulfonamide;2-methylpropane?
The canonical SMILES for benzenesulfonamide;2-methylpropane is CC(C)C.NS(=O)(=O)c1ccccc1.
What is the InChIKey of benzenesulfonamide;2-methylpropane?
The InChIKey is BHMMRYPINNRSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S.C4H10/c7-10(8,9)6-4-2-1-3-5-6;1-4(2)3/h1-5H,(H2,7,8,9);4H,1-3H3.
What are the key properties of benzenesulfonamide;2-methylpropane?
benzenesulfonamide;2-methylpropane has a molecular weight of 215.32 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonamide;2-methylpropane is sourced from PubChem (CID 157350693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).