C16H21F3N2O6S2 — CID 160752495
benzenesulfonamide;propan-2-ol;N-(trifluoromethoxy)benzenesulfonamide (PubChem CID 160752495) has the molecular formula C16H21F3N2O6S2 and a molecular weight of 458.48 g/mol. Its IUPAC name is benzenesulfonamide;propan-2-ol;N-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | benzenesulfonamide;propan-2-ol;N-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 160752495 |
| Molecular Formula | C16H21F3N2O6S2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | benzenesulfonamide;propan-2-ol;N-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC(C)O.NS(=O)(=O)c1ccccc1.O=S(=O)(NOC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C7H6F3NO3S.C6H7NO2S.C3H8O/c8-7(9,10)14-11-15(12,13)6-4-2-1-3-5-6;7-10(8,9)6-4-2-1-3-5-6;1-3(2)4/h1-5,11H;1-5H,(H2,7,8,9);3-4H,1-2H3 |
| InChIKey | RWZYIRNPJNONGA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|