benzenesulfonamide;boric acid

C6H10BNO5S — CID 160795607

IUPACbenzenesulfonamide;boric acid
SMILESNS(=O)(=O)c1ccccc1.OB(O)O
InChIInChI=1S/C6H7NO2S.BH3O3/c7-10(8,9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H2,7,8,9);2-4H
InChIKeySCKAZMIJVDLRDT-UHFFFAOYSA-N
MW219.03 g/mol
LogP-1.72
Rot. Bonds1

About benzenesulfonamide;boric acid

benzenesulfonamide;boric acid (PubChem CID 160795607) has the molecular formula C6H10BNO5S and a molecular weight of 219.03 g/mol. Its IUPAC name is benzenesulfonamide;boric acid.

Molecular Properties

Compound Namebenzenesulfonamide;boric acid
PubChem CID160795607
Molecular FormulaC6H10BNO5S
Molecular Weight219.03 g/mol
Exact Mass219.04
IUPAC Namebenzenesulfonamide;boric acid
SMILESNS(=O)(=O)c1ccccc1.OB(O)O
InChIInChI=1S/C6H7NO2S.BH3O3/c7-10(8,9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H2,7,8,9);2-4H
InChIKeySCKAZMIJVDLRDT-UHFFFAOYSA-N
XLogP-1.72
TPSA120.85 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.03
LogP ≤ 5-1.72
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze benzenesulfonamide;boric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzenesulfonamide;boric acid?
The IUPAC name of benzenesulfonamide;boric acid (CID 160795607) is benzenesulfonamide;boric acid.
What is the SMILES notation for benzenesulfonamide;boric acid?
The canonical SMILES for benzenesulfonamide;boric acid is NS(=O)(=O)c1ccccc1.OB(O)O.
What is the InChIKey of benzenesulfonamide;boric acid?
The InChIKey is SCKAZMIJVDLRDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S.BH3O3/c7-10(8,9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H2,7,8,9);2-4H.
What are the key properties of benzenesulfonamide;boric acid?
benzenesulfonamide;boric acid has a molecular weight of 219.03 g/mol, XLogP of -1.72, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonamide;boric acid is sourced from PubChem (CID 160795607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).