C9H6F7NO3S — CID 164941118
N-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)benzenesulfonamide (PubChem CID 164941118) has the molecular formula C9H6F7NO3S and a molecular weight of 341.20 g/mol. Its IUPAC name is N-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)benzenesulfonamide.
| Compound Name | N-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)benzenesulfonamide |
|---|---|
| PubChem CID | 164941118 |
| Molecular Formula | C9H6F7NO3S |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | N-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)benzenesulfonamide |
| SMILES | O=S(=O)(NOC(F)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H6F7NO3S/c10-7(8(11,12)13,9(14,15)16)20-17-21(18,19)6-4-2-1-3-5-6/h1-5,17H |
| InChIKey | ASQWSXCPYPCQAU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|