C14H12F4N2O8S4 — CID 126606304
N,N'-bis(benzenesulfonyl)-1,1,2,2-tetrafluoroethane-1,2-disulfonamide (PubChem CID 126606304) has the molecular formula C14H12F4N2O8S4 and a molecular weight of 540.52 g/mol. Its IUPAC name is N,N'-bis(benzenesulfonyl)-1,1,2,2-tetrafluoroethane-1,2-disulfonamide.
| Compound Name | N,N'-bis(benzenesulfonyl)-1,1,2,2-tetrafluoroethane-1,2-disulfonamide |
|---|---|
| PubChem CID | 126606304 |
| Molecular Formula | C14H12F4N2O8S4 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 539.94 |
| IUPAC Name | N,N'-bis(benzenesulfonyl)-1,1,2,2-tetrafluoroethane-1,2-disulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12F4N2O8S4/c15-13(16,31(25,26)19-29(21,22)11-7-3-1-4-8-11)14(17,18)32(27,28)20-30(23,24)12-9-5-2-6-10-12/h1-10,19-20H |
| InChIKey | RAAFXCMYFUBJPT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|