C10H14F3NO5S2 — CID 144895796
ethane;4-methoxy-N-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 144895796) has the molecular formula C10H14F3NO5S2 and a molecular weight of 349.35 g/mol. Its IUPAC name is ethane;4-methoxy-N-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | ethane;4-methoxy-N-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 144895796 |
| Molecular Formula | C10H14F3NO5S2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | ethane;4-methoxy-N-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | CC.COc1ccc(S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H8F3NO5S2.C2H6/c1-17-6-2-4-7(5-3-6)18(13,14)12-19(15,16)8(9,10)11;1-2/h2-5,12H,1H3;1-2H3 |
| InChIKey | JMGXQRZBDGPOAO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |