C14H12F3NO4S2 — CID 139422293
6-prop-1-en-2-yl-N-(trifluoromethylsulfonyl)naphthalene-2-sulfonamide (PubChem CID 139422293) has the molecular formula C14H12F3NO4S2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 6-prop-1-en-2-yl-N-(trifluoromethylsulfonyl)naphthalene-2-sulfonamide.
| Compound Name | 6-prop-1-en-2-yl-N-(trifluoromethylsulfonyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 139422293 |
| Molecular Formula | C14H12F3NO4S2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 6-prop-1-en-2-yl-N-(trifluoromethylsulfonyl)naphthalene-2-sulfonamide |
| SMILES | C=C(C)c1ccc2cc(S(=O)(=O)NS(=O)(=O)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C14H12F3NO4S2/c1-9(2)10-3-4-12-8-13(6-5-11(12)7-10)23(19,20)18-24(21,22)14(15,16)17/h3-8,18H,1H2,2H3 |
| InChIKey | JFOCWBQGKXKVME-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |