C15H22F3NO4S2 — CID 156529293
4-(2,5-dimethylhexan-3-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 156529293) has the molecular formula C15H22F3NO4S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-(2,5-dimethylhexan-3-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-(2,5-dimethylhexan-3-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 156529293 |
| Molecular Formula | C15H22F3NO4S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-(2,5-dimethylhexan-3-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | CC(C)CC(c1ccc(S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C15H22F3NO4S2/c1-10(2)9-14(11(3)4)12-5-7-13(8-6-12)24(20,21)19-25(22,23)15(16,17)18/h5-8,10-11,14,19H,9H2,1-4H3 |
| InChIKey | YIRXVGSRDSZQCJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |