C13H18F3NO5S2 — CID 155765023
4-(1-propoxypropan-2-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 155765023) has the molecular formula C13H18F3NO5S2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 4-(1-propoxypropan-2-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-(1-propoxypropan-2-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155765023 |
| Molecular Formula | C13H18F3NO5S2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 4-(1-propoxypropan-2-yl)-N-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | CCCOCC(C)c1ccc(S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO5S2/c1-3-8-22-9-10(2)11-4-6-12(7-5-11)23(18,19)17-24(20,21)13(14,15)16/h4-7,10,17H,3,8-9H2,1-2H3 |
| InChIKey | ZZHHLBUQUGRGNA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|