C24H33F3NO7PS2 — CID 177097692
4-[5-[4-(diethoxyphosphorylmethyl)phenyl]hexan-3-yl]-N-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 177097692) has the molecular formula C24H33F3NO7PS2 and a molecular weight of 599.63 g/mol. Its IUPAC name is 4-[5-[4-(diethoxyphosphorylmethyl)phenyl]hexan-3-yl]-N-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-[5-[4-(diethoxyphosphorylmethyl)phenyl]hexan-3-yl]-N-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177097692 |
| Molecular Formula | C24H33F3NO7PS2 |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | 4-[5-[4-(diethoxyphosphorylmethyl)phenyl]hexan-3-yl]-N-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | CCOP(=O)(Cc1ccc(C(C)CC(CC)c2ccc(S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc2)cc1)OCC |
| InChI | InChI=1S/C24H33F3NO7PS2/c1-5-20(22-12-14-23(15-13-22)37(30,31)28-38(32,33)24(25,26)27)16-18(4)21-10-8-19(9-11-21)17-36(29,34-6-2)35-7-3/h8-15,18,20,28H,5-7,16-17H2,1-4H3 |
| InChIKey | SDYNTSTVIFHMGI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|