C45H64O12P4 — CID 10920093
1-(diethoxyphosphorylmethyl)-4-[tris[4-(diethoxyphosphorylmethyl)phenyl]methyl]benzene (PubChem CID 10920093) has the molecular formula C45H64O12P4 and a molecular weight of 920.89 g/mol. Its IUPAC name is 1-(diethoxyphosphorylmethyl)-4-[tris[4-(diethoxyphosphorylmethyl)phenyl]methyl]benzene.
| Compound Name | 1-(diethoxyphosphorylmethyl)-4-[tris[4-(diethoxyphosphorylmethyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 10920093 |
| Molecular Formula | C45H64O12P4 |
| Molecular Weight | 920.89 g/mol |
| Exact Mass | 920.33 |
| IUPAC Name | 1-(diethoxyphosphorylmethyl)-4-[tris[4-(diethoxyphosphorylmethyl)phenyl]methyl]benzene |
| SMILES | CCOP(=O)(Cc1ccc(C(c2ccc(CP(=O)(OCC)OCC)cc2)(c2ccc(CP(=O)(OCC)OCC)cc2)c2ccc(CP(=O)(OCC)OCC)cc2)cc1)OCC |
| InChI | InChI=1S/C45H64O12P4/c1-9-50-58(46,51-10-2)33-37-17-25-41(26-18-37)45(42-27-19-38(20-28-42)34-59(47,52-11-3)53-12-4,43-29-21-39(22-30-43)35-60(48,54-13-5)55-14-6)44-31-23-40(24-32-44)36-61(49,56-15-7)57-16-8/h17-32H,9-16,33-36H2,1-8H3 |
| InChIKey | YNFGGYOXOWFOTR-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.89 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|