C20H25N2O3P — CID 58763687
2-[[4-(diethoxyphosphorylmethyl)phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (PubChem CID 58763687) has the molecular formula C20H25N2O3P and a molecular weight of 372.41 g/mol. Its IUPAC name is 2-[[4-(diethoxyphosphorylmethyl)phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole.
| Compound Name | 2-[[4-(diethoxyphosphorylmethyl)phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 58763687 |
| Molecular Formula | C20H25N2O3P |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[[4-(diethoxyphosphorylmethyl)phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| SMILES | CCOP(=O)(Cc1ccc(C(c2ccc[nH]2)c2ccc[nH]2)cc1)OCC |
| InChI | InChI=1S/C20H25N2O3P/c1-3-24-26(23,25-4-2)15-16-9-11-17(12-10-16)20(18-7-5-13-21-18)19-8-6-14-22-19/h5-14,20-22H,3-4,15H2,1-2H3 |
| InChIKey | RPYJLUJCTUVKIV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|