C16H27ClO6P2 — CID 10740436
1-[chloro(diethoxyphosphoryl)methyl]-3-(diethoxyphosphorylmethyl)benzene (PubChem CID 10740436) has the molecular formula C16H27ClO6P2 and a molecular weight of 412.79 g/mol. Its IUPAC name is 1-[chloro(diethoxyphosphoryl)methyl]-3-(diethoxyphosphorylmethyl)benzene.
| Compound Name | 1-[chloro(diethoxyphosphoryl)methyl]-3-(diethoxyphosphorylmethyl)benzene |
|---|---|
| PubChem CID | 10740436 |
| Molecular Formula | C16H27ClO6P2 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1-[chloro(diethoxyphosphoryl)methyl]-3-(diethoxyphosphorylmethyl)benzene |
| SMILES | CCOP(=O)(Cc1cccc(C(Cl)P(=O)(OCC)OCC)c1)OCC |
| InChI | InChI=1S/C16H27ClO6P2/c1-5-20-24(18,21-6-2)13-14-10-9-11-15(12-14)16(17)25(19,22-7-3)23-8-4/h9-12,16H,5-8,13H2,1-4H3 |
| InChIKey | MHBOWLSLAJUOJZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|