C46H55N2O6P3 — CID 89297003
2-[1H-pyrrol-2-yl-[4-[tris[4-[[ethoxy(methyl)phosphoryl]methyl]phenyl]methyl]phenyl]methyl]-1H-pyrrole (PubChem CID 89297003) has the molecular formula C46H55N2O6P3 and a molecular weight of 824.88 g/mol. Its IUPAC name is 2-[1H-pyrrol-2-yl-[4-[tris[4-[[ethoxy(methyl)phosphoryl]methyl]phenyl]methyl]phenyl]methyl]-1H-pyrrole.
| Compound Name | 2-[1H-pyrrol-2-yl-[4-[tris[4-[[ethoxy(methyl)phosphoryl]methyl]phenyl]methyl]phenyl]methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 89297003 |
| Molecular Formula | C46H55N2O6P3 |
| Molecular Weight | 824.88 g/mol |
| Exact Mass | 824.33 |
| IUPAC Name | 2-[1H-pyrrol-2-yl-[4-[tris[4-[[ethoxy(methyl)phosphoryl]methyl]phenyl]methyl]phenyl]methyl]-1H-pyrrole |
| SMILES | CCOP(C)(=O)Cc1ccc(C(c2ccc(CP(C)(=O)OCC)cc2)(c2ccc(CP(C)(=O)OCC)cc2)c2ccc(C(c3ccc[nH]3)c3ccc[nH]3)cc2)cc1 |
| InChI | InChI=1S/C46H55N2O6P3/c1-7-52-55(4,49)32-35-14-22-39(23-15-35)46(40-24-16-36(17-25-40)33-56(5,50)53-8-2,41-26-18-37(19-27-41)34-57(6,51)54-9-3)42-28-20-38(21-29-42)45(43-12-10-30-47-43)44-13-11-31-48-44/h10-31,45,47-48H,7-9,32-34H2,1-6H3 |
| InChIKey | ONEQDNYYKJFGBM-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.88 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|