C31H34N2OSi — CID 10624502
[5-[(4-tert-butylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone (PubChem CID 10624502) has the molecular formula C31H34N2OSi and a molecular weight of 478.71 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone.
| Compound Name | [5-[(4-tert-butylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 10624502 |
| Molecular Formula | C31H34N2OSi |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [5-[(4-tert-butylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]-[4-(2-trimethylsilylethynyl)phenyl]methanone |
| SMILES | CC(C)(C)c1ccc(C(c2ccc[nH]2)c2ccc(C(=O)c3ccc(C#C[Si](C)(C)C)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C31H34N2OSi/c1-31(2,3)25-15-13-23(14-16-25)29(26-8-7-20-32-26)27-17-18-28(33-27)30(34)24-11-9-22(10-12-24)19-21-35(4,5)6/h7-18,20,29,32-33H,1-6H3 |
| InChIKey | HXCDWRZLNSBBFS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|