C29H32N2O3Si — CID 10928999
2-trimethylsilylethyl 4-[[5-(4-methylbenzoyl)-1H-pyrrol-2-yl]-(1H-pyrrol-2-yl)methyl]benzoate (PubChem CID 10928999) has the molecular formula C29H32N2O3Si and a molecular weight of 484.67 g/mol. Its IUPAC name is 2-trimethylsilylethyl 4-[[5-(4-methylbenzoyl)-1H-pyrrol-2-yl]-(1H-pyrrol-2-yl)methyl]benzoate.
| Compound Name | 2-trimethylsilylethyl 4-[[5-(4-methylbenzoyl)-1H-pyrrol-2-yl]-(1H-pyrrol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 10928999 |
| Molecular Formula | C29H32N2O3Si |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-trimethylsilylethyl 4-[[5-(4-methylbenzoyl)-1H-pyrrol-2-yl]-(1H-pyrrol-2-yl)methyl]benzoate |
| SMILES | Cc1ccc(C(=O)c2ccc(C(c3ccc(C(=O)OCC[Si](C)(C)C)cc3)c3ccc[nH]3)[nH]2)cc1 |
| InChI | InChI=1S/C29H32N2O3Si/c1-20-7-9-22(10-8-20)28(32)26-16-15-25(31-26)27(24-6-5-17-30-24)21-11-13-23(14-12-21)29(33)34-18-19-35(2,3)4/h5-17,27,30-31H,18-19H2,1-4H3 |
| InChIKey | BVVOLIVEDYWGJK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|