C39H34N2O4Si — CID 10908300
2-trimethylsilylethyl 4-[bis[5-(4-ethynylbenzoyl)-1H-pyrrol-2-yl]methyl]benzoate (PubChem CID 10908300) has the molecular formula C39H34N2O4Si and a molecular weight of 622.80 g/mol. Its IUPAC name is 2-trimethylsilylethyl 4-[bis[5-(4-ethynylbenzoyl)-1H-pyrrol-2-yl]methyl]benzoate.
| Compound Name | 2-trimethylsilylethyl 4-[bis[5-(4-ethynylbenzoyl)-1H-pyrrol-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10908300 |
| Molecular Formula | C39H34N2O4Si |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | 2-trimethylsilylethyl 4-[bis[5-(4-ethynylbenzoyl)-1H-pyrrol-2-yl]methyl]benzoate |
| SMILES | C#Cc1ccc(C(=O)c2ccc(C(c3ccc(C(=O)OCC[Si](C)(C)C)cc3)c3ccc(C(=O)c4ccc(C#C)cc4)[nH]3)[nH]2)cc1 |
| InChI | InChI=1S/C39H34N2O4Si/c1-6-26-8-12-29(13-9-26)37(42)34-22-20-32(40-34)36(28-16-18-31(19-17-28)39(44)45-24-25-46(3,4)5)33-21-23-35(41-33)38(43)30-14-10-27(7-2)11-15-30/h1-2,8-23,36,40-41H,24-25H2,3-5H3 |
| InChIKey | OELZVIIDSZXVSA-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|