C52H49N4O3P — CID 91111553
5-[4-(diethoxyphosphorylmethyl)phenyl]-10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91111553) has the molecular formula C52H49N4O3P and a molecular weight of 808.96 g/mol. Its IUPAC name is 5-[4-(diethoxyphosphorylmethyl)phenyl]-10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5-[4-(diethoxyphosphorylmethyl)phenyl]-10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91111553 |
| Molecular Formula | C52H49N4O3P |
| Molecular Weight | 808.96 g/mol |
| Exact Mass | 808.35 |
| IUPAC Name | 5-[4-(diethoxyphosphorylmethyl)phenyl]-10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCOP(=O)(Cc1ccc(C2=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc([nH]3)C(c3ccc(C)cc3)=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc2[nH]3)cc1)OCC |
| InChI | InChI=1S/C52H49N4O3P/c1-6-58-60(57,59-7-2)32-36-14-22-40(23-15-36)52-47-30-28-45(55-47)50(38-18-10-34(4)11-19-38)43-26-24-41(53-43)49(37-16-8-33(3)9-17-37)42-25-27-44(54-42)51(46-29-31-48(52)56-46)39-20-12-35(5)13-21-39/h8-31,53-56H,6-7,32H2,1-5H3 |
| InChIKey | LXZRJHQZBMODCV-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.96 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|