C44H36N4O12P4 — CID 57074987
[4-[10,15,20-tris(4-phosphonophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]phosphonic acid (PubChem CID 57074987) has the molecular formula C44H36N4O12P4 and a molecular weight of 936.68 g/mol. Its IUPAC name is [4-[10,15,20-tris(4-phosphonophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]phosphonic acid.
| Compound Name | [4-[10,15,20-tris(4-phosphonophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 57074987 |
| Molecular Formula | C44H36N4O12P4 |
| Molecular Weight | 936.68 g/mol |
| Exact Mass | 936.13 |
| IUPAC Name | [4-[10,15,20-tris(4-phosphonophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(C2=c3ccc([nH]3)=C(c3ccc(P(=O)(O)O)cc3)c3ccc([nH]3)C(c3ccc(P(=O)(O)O)cc3)=c3ccc([nH]3)=C(c3ccc(P(=O)(O)O)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C44H36N4O12P4/c49-61(50,51)29-9-1-25(2-10-29)41-33-17-19-35(45-33)42(26-3-11-30(12-4-26)62(52,53)54)37-21-23-39(47-37)44(28-7-15-32(16-8-28)64(58,59)60)40-24-22-38(48-40)43(36-20-18-34(41)46-36)27-5-13-31(14-6-27)63(55,56)57/h1-24,45-48H,(H2,49,50,51)(H2,52,53,54)(H2,55,56,57)(H2,58,59,60) |
| InChIKey | MZKVXUFYBOROSK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 293.28 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|