C48H32N4O4 — CID 123358808
4-[10,15,20-tris(4-formylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde (PubChem CID 123358808) has the molecular formula C48H32N4O4 and a molecular weight of 728.81 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-formylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[10,15,20-tris(4-formylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 123358808 |
| Molecular Formula | C48H32N4O4 |
| Molecular Weight | 728.81 g/mol |
| Exact Mass | 728.24 |
| IUPAC Name | 4-[10,15,20-tris(4-formylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde |
| SMILES | O=Cc1ccc(C2=c3ccc([nH]3)=C(c3ccc(C=O)cc3)c3ccc([nH]3)C(c3ccc(C=O)cc3)=c3ccc([nH]3)=C(c3ccc(C=O)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C48H32N4O4/c53-25-29-1-9-33(10-2-29)45-37-17-19-39(49-37)46(34-11-3-30(26-54)4-12-34)41-21-23-43(51-41)48(36-15-7-32(28-56)8-16-36)44-24-22-42(52-44)47(40-20-18-38(45)50-40)35-13-5-31(27-55)6-14-35/h1-28,49-52H |
| InChIKey | CCNUGHUEUWKUAL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.81 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|