C36H30N4O — CID 91151416
4-[15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde (PubChem CID 91151416) has the molecular formula C36H30N4O and a molecular weight of 534.66 g/mol. Its IUPAC name is 4-[15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 91151416 |
| Molecular Formula | C36H30N4O |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 4-[15-(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzaldehyde |
| SMILES | Cc1cc(C)c(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3ccc(C=O)cc3)=c3ccc([nH]3)=Cc3ccc2[nH]3)c(C)c1 |
| InChI | InChI=1S/C36H30N4O/c1-21-16-22(2)34(23(3)17-21)36-32-14-10-28(39-32)18-26-8-12-30(37-26)35(25-6-4-24(20-41)5-7-25)31-13-9-27(38-31)19-29-11-15-33(36)40-29/h4-20,37-40H,1-3H3 |
| InChIKey | CIQYHQGBTDKJJD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|