C38H37BrN4 — CID 136614340
15-bromo-12,12-dimethyl-5-(4-methylphenyl)-20-(2,4,6-trimethylphenyl)-13,21,22,24-tetrahydro-2H-porphyrin (PubChem CID 136614340) has the molecular formula C38H37BrN4 and a molecular weight of 629.65 g/mol. Its IUPAC name is 15-bromo-12,12-dimethyl-5-(4-methylphenyl)-20-(2,4,6-trimethylphenyl)-13,21,22,24-tetrahydro-2H-porphyrin.
| Compound Name | 15-bromo-12,12-dimethyl-5-(4-methylphenyl)-20-(2,4,6-trimethylphenyl)-13,21,22,24-tetrahydro-2H-porphyrin |
|---|---|
| PubChem CID | 136614340 |
| Molecular Formula | C38H37BrN4 |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 15-bromo-12,12-dimethyl-5-(4-methylphenyl)-20-(2,4,6-trimethylphenyl)-13,21,22,24-tetrahydro-2H-porphyrin |
| SMILES | Cc1ccc(C2=c3ccc([nH]3)=CC3=NC(=C(Br)c4ccc([nH]4)C(c4c(C)cc(C)cc4C)=C4CC=C2N4)CC3(C)C)cc1 |
| InChI | InChI=1S/C38H37BrN4/c1-21-7-9-25(10-8-21)35-27-12-11-26(40-27)19-33-38(5,6)20-32(43-33)37(39)31-16-15-30(42-31)36(29-14-13-28(35)41-29)34-23(3)17-22(2)18-24(34)4/h7-13,15-19,40-42H,14,20H2,1-6H3 |
| InChIKey | FTHBIYBWGOYZBV-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 55.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |