C38H34N7+3 — CID 91607020
5,10,15-tris(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91607020) has the molecular formula C38H34N7+3 and a molecular weight of 588.74 g/mol. Its IUPAC name is 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91607020 |
| Molecular Formula | C38H34N7+3 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | C[n+]1ccc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3cc[n+](C)cc3)=c3ccc([nH]3)=C(c3cc[n+](C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C38H32N7/c1-43-18-12-25(13-19-43)36-30-6-4-28(39-30)24-29-5-7-31(40-29)37(26-14-20-44(2)21-15-26)33-9-11-35(42-33)38(34-10-8-32(36)41-34)27-16-22-45(3)23-17-27/h4-24H,1-3H3,(H2,39,40,41,42)/q+1/p+2 |
| InChIKey | OHRROAGUXHSYHY-UHFFFAOYSA-P |
| XLogP | 1.36 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|