C49H49N5O2 — CID 90687233
tert-butyl N-[4-[10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]carbamate (PubChem CID 90687233) has the molecular formula C49H49N5O2 and a molecular weight of 739.96 g/mol. Its IUPAC name is tert-butyl N-[4-[10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 90687233 |
| Molecular Formula | C49H49N5O2 |
| Molecular Weight | 739.96 g/mol |
| Exact Mass | 739.39 |
| IUPAC Name | tert-butyl N-[4-[10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl]carbamate |
| SMILES | Cc1cc(C)c(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3c(C)cc(C)cc3C)=c3ccc([nH]3)=C(c3ccc(NC(=O)OC(C)(C)C)cc3)c3ccc2[nH]3)c(C)c1 |
| InChI | InChI=1S/C49H49N5O2/c1-27-22-29(3)43(30(4)23-27)46-39-16-14-35(50-39)26-36-15-17-40(51-36)47(44-31(5)24-28(2)25-32(44)6)42-21-19-38(54-42)45(37-18-20-41(46)53-37)33-10-12-34(13-11-33)52-48(55)56-49(7,8)9/h10-26,50-51,53-54H,1-9H3,(H,52,55) |
| InChIKey | WAYRDKDNZDCULB-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.96 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |