C32H22N6O6 — CID 54545974
5-[10-(3-hydroxy-4-nitrophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]-2-nitrophenol (PubChem CID 54545974) has the molecular formula C32H22N6O6 and a molecular weight of 586.56 g/mol. Its IUPAC name is 5-[10-(3-hydroxy-4-nitrophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]-2-nitrophenol.
| Compound Name | 5-[10-(3-hydroxy-4-nitrophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]-2-nitrophenol |
|---|---|
| PubChem CID | 54545974 |
| Molecular Formula | C32H22N6O6 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 5-[10-(3-hydroxy-4-nitrophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]-2-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(C2=c3ccc([nH]3)=C(c3ccc([N+](=O)[O-])c(O)c3)c3ccc([nH]3)C=c3ccc([nH]3)=Cc3ccc2[nH]3)cc1O |
| InChI | InChI=1S/C32H22N6O6/c39-29-13-17(1-11-27(29)37(41)42)31-23-7-5-21(34-23)15-19-3-4-20(33-19)16-22-6-8-24(35-22)32(26-10-9-25(31)36-26)18-2-12-28(38(43)44)30(40)14-18/h1-16,33-36,39-40H |
| InChIKey | OUIZQVWUJYHCTN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 189.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|