C20H16HgN4 — CID 158242676
mercury;21,22,23,24-tetrahydroporphyrin (PubChem CID 158242676) has the molecular formula C20H16HgN4 and a molecular weight of 512.97 g/mol. Its IUPAC name is mercury;21,22,23,24-tetrahydroporphyrin.
| Compound Name | mercury;21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 158242676 |
| Molecular Formula | C20H16HgN4 |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | mercury;21,22,23,24-tetrahydroporphyrin |
| SMILES | C1=c2ccc([nH]2)=Cc2ccc([nH]2)C=c2ccc([nH]2)=Cc2ccc1[nH]2.[Hg] |
| InChI | InChI=1S/C20H16N4.Hg/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12,21-24H; |
| InChIKey | FALSIMVYGCWCAA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|