C24H18N4O4 — CID 90700882
2-(21,22,23,24-tetrahydroporphyrin-5-ylmethylidene)propanedioic acid (PubChem CID 90700882) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-(21,22,23,24-tetrahydroporphyrin-5-ylmethylidene)propanedioic acid.
| Compound Name | 2-(21,22,23,24-tetrahydroporphyrin-5-ylmethylidene)propanedioic acid |
|---|---|
| PubChem CID | 90700882 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-(21,22,23,24-tetrahydroporphyrin-5-ylmethylidene)propanedioic acid |
| SMILES | O=C(O)C(=CC1=c2ccc([nH]2)=Cc2ccc([nH]2)C=c2ccc([nH]2)=Cc2ccc1[nH]2)C(=O)O |
| InChI | InChI=1S/C24H18N4O4/c29-23(30)20(24(31)32)12-19-21-7-5-17(27-21)10-15-3-1-13(25-15)9-14-2-4-16(26-14)11-18-6-8-22(19)28-18/h1-12,25-28H,(H,29,30)(H,31,32) |
| InChIKey | JZXSKPTZGROGBE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|