C27H16F5N5O — CID 91574748
2,3,4,5,6-pentafluoro-N-(21,22,23,24-tetrahydroporphyrin-5-yl)benzamide (PubChem CID 91574748) has the molecular formula C27H16F5N5O and a molecular weight of 521.45 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(21,22,23,24-tetrahydroporphyrin-5-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(21,22,23,24-tetrahydroporphyrin-5-yl)benzamide |
|---|---|
| PubChem CID | 91574748 |
| Molecular Formula | C27H16F5N5O |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(21,22,23,24-tetrahydroporphyrin-5-yl)benzamide |
| SMILES | O=C(NC1=c2ccc([nH]2)=Cc2ccc([nH]2)C=c2ccc([nH]2)=Cc2ccc1[nH]2)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H16F5N5O/c28-21-20(22(29)24(31)25(32)23(21)30)27(38)37-26-18-7-5-16(35-18)10-14-3-1-12(33-14)9-13-2-4-15(34-13)11-17-6-8-19(26)36-17/h1-11,33-36H,(H,37,38) |
| InChIKey | JSINYBYDKPSGSV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|