C28H16F4N2O2 — CID 5018859
2,3,5,6-tetrafluoro-1-N,4-N-dinaphthalen-2-ylbenzene-1,4-dicarboxamide (PubChem CID 5018859) has the molecular formula C28H16F4N2O2 and a molecular weight of 488.44 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-1-N,4-N-dinaphthalen-2-ylbenzene-1,4-dicarboxamide.
| Compound Name | 2,3,5,6-tetrafluoro-1-N,4-N-dinaphthalen-2-ylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 5018859 |
| Molecular Formula | C28H16F4N2O2 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2,3,5,6-tetrafluoro-1-N,4-N-dinaphthalen-2-ylbenzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1c(F)c(F)c(C(=O)Nc2ccc3ccccc3c2)c(F)c1F |
| InChI | InChI=1S/C28H16F4N2O2/c29-23-21(27(35)33-19-11-9-15-5-1-3-7-17(15)13-19)24(30)26(32)22(25(23)31)28(36)34-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H,(H,33,35)(H,34,36) |
| InChIKey | HRPIGOMAYWJXBS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|